C25H31F3N3S- — CID 140780359
4-(2,5-dihexylthiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 140780359) has the molecular formula C25H31F3N3S- and a molecular weight of 462.61 g/mol. Its IUPAC name is 4-(2,5-dihexylthiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 4-(2,5-dihexylthiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 140780359 |
| Molecular Formula | C25H31F3N3S- |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-(2,5-dihexylthiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | CCCCCCc1cc(-c2ccnc(-c3cc(C(F)(F)F)n[n-]3)c2)c(CCCCCC)s1 |
| InChI | InChI=1S/C25H31F3N3S/c1-3-5-7-9-11-19-16-20(23(32-19)12-10-8-6-4-2)18-13-14-29-21(15-18)22-17-24(31-30-22)25(26,27)28/h13-17H,3-12H2,1-2H3/q-1 |
| InChIKey | IZSNFHQFSLTAKP-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|