C16H18BrF3N2O2SSi — CID 140780811
N-(5-bromo-1,3-thiazol-2-yl)-2,3,6-trifluoro-N-(2-trimethylsilylethoxymethyl)benzamide (PubChem CID 140780811) has the molecular formula C16H18BrF3N2O2SSi and a molecular weight of 467.38 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-2,3,6-trifluoro-N-(2-trimethylsilylethoxymethyl)benzamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-2,3,6-trifluoro-N-(2-trimethylsilylethoxymethyl)benzamide |
|---|---|
| PubChem CID | 140780811 |
| Molecular Formula | C16H18BrF3N2O2SSi |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 466.00 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-2,3,6-trifluoro-N-(2-trimethylsilylethoxymethyl)benzamide |
| SMILES | C[Si](C)(C)CCOCN(C(=O)c1c(F)ccc(F)c1F)c1ncc(Br)s1 |
| InChI | InChI=1S/C16H18BrF3N2O2SSi/c1-26(2,3)7-6-24-9-22(16-21-8-12(17)25-16)15(23)13-10(18)4-5-11(19)14(13)20/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | JFPNJDWFNLNSIK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|