C16H22F2N2O2Si — CID 140781410
2-amino-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)acetamide (PubChem CID 140781410) has the molecular formula C16H22F2N2O2Si and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-amino-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)acetamide.
| Compound Name | 2-amino-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)acetamide |
|---|---|
| PubChem CID | 140781410 |
| Molecular Formula | C16H22F2N2O2Si |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-amino-N-(3,5-difluoro-4-trimethylsilylphenyl)-2-(3,6-dihydro-2H-pyran-4-yl)acetamide |
| SMILES | C[Si](C)(C)c1c(F)cc(NC(=O)C(N)C2=CCOCC2)cc1F |
| InChI | InChI=1S/C16H22F2N2O2Si/c1-23(2,3)15-12(17)8-11(9-13(15)18)20-16(21)14(19)10-4-6-22-7-5-10/h4,8-9,14H,5-7,19H2,1-3H3,(H,20,21) |
| InChIKey | LUYALGKJTVHPBU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|