C42H30FN7O — CID 140782776
10-[6-(9,9-dimethyl-4a,9a-dihydroacridin-10-yl)-3-fluoro-2-isocyanopyrazino[2,3-f][1,10]phenanthrolin-10-yl]-1,2-dihydrophenoxazine (PubChem CID 140782776) has the molecular formula C42H30FN7O and a molecular weight of 667.75 g/mol. Its IUPAC name is 10-[6-(9,9-dimethyl-4a,9a-dihydroacridin-10-yl)-3-fluoro-2-isocyanopyrazino[2,3-f][1,10]phenanthrolin-10-yl]-1,2-dihydrophenoxazine.
| Compound Name | 10-[6-(9,9-dimethyl-4a,9a-dihydroacridin-10-yl)-3-fluoro-2-isocyanopyrazino[2,3-f][1,10]phenanthrolin-10-yl]-1,2-dihydrophenoxazine |
|---|---|
| PubChem CID | 140782776 |
| Molecular Formula | C42H30FN7O |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.25 |
| IUPAC Name | 10-[6-(9,9-dimethyl-4a,9a-dihydroacridin-10-yl)-3-fluoro-2-isocyanopyrazino[2,3-f][1,10]phenanthrolin-10-yl]-1,2-dihydrophenoxazine |
| SMILES | [C-]#[N+]c1nc2c3ccc(N4C5=C(C=CCC5)Oc5ccccc54)nc3c3ncc(N4c5ccccc5C(C)(C)C5C=CC=CC54)cc3c2nc1F |
| InChI | InChI=1S/C42H30FN7O/c1-42(2)27-12-4-6-14-29(27)49(30-15-7-5-13-28(30)42)24-22-26-36(45-23-24)37-25(38-39(26)47-40(43)41(44-3)48-38)20-21-35(46-37)50-31-16-8-10-18-33(31)51-34-19-11-9-17-32(34)50/h4-8,10-16,18-23,27,29H,9,17H2,1-2H3 |
| InChIKey | QMTGJERBMFXVOP-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|