C23H35N2+ — CID 140783683
(1R,5S)-3-[(2R)-2-[(1R)-cyclohex-2-en-1-yl]-2-cyclohex-3-en-1-yl-2-isocyanoethyl]-8-methyl-8-azoniabicyclo[3.2.1]octane (PubChem CID 140783683) has the molecular formula C23H35N2+ and a molecular weight of 339.55 g/mol. Its IUPAC name is (1R,5S)-3-[(2R)-2-[(1R)-cyclohex-2-en-1-yl]-2-cyclohex-3-en-1-yl-2-isocyanoethyl]-8-methyl-8-azoniabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-[(2R)-2-[(1R)-cyclohex-2-en-1-yl]-2-cyclohex-3-en-1-yl-2-isocyanoethyl]-8-methyl-8-azoniabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 140783683 |
| Molecular Formula | C23H35N2+ |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | (1R,5S)-3-[(2R)-2-[(1R)-cyclohex-2-en-1-yl]-2-cyclohex-3-en-1-yl-2-isocyanoethyl]-8-methyl-8-azoniabicyclo[3.2.1]octane |
| SMILES | [C-]#[N+][C@](CC1C[C@H]2CC[C@@H](C1)[NH+]2C)(C1CC=CCC1)[C@H]1C=CCCC1 |
| InChI | InChI=1S/C23H34N2/c1-24-23(19-9-5-3-6-10-19,20-11-7-4-8-12-20)17-18-15-21-13-14-22(16-18)25(21)2/h3,5,7,11,18-22H,4,6,8-10,12-17H2,2H3/p+1/t18?,19?,20-,21-,22+,23+/m0/s1 |
| InChIKey | IPPPHACPLCXSLL-YZYAFWJZSA-O |
| XLogP | 4.20 |
| TPSA | 8.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|