About 2-(1H-imidazol-2-yl)benzamide;hydrate
2-(1H-imidazol-2-yl)benzamide;hydrate (PubChem CID 140783933) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)benzamide;hydrate.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)benzamide;hydrate |
| PubChem CID | 140783933 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(1H-imidazol-2-yl)benzamide;hydrate |
| SMILES | NC(=O)c1ccccc1-c1ncc[nH]1.O |
| InChI | InChI=1S/C10H9N3O.H2O/c11-9(14)7-3-1-2-4-8(7)10-12-5-6-13-10;/h1-6H,(H2,11,14)(H,12,13);1H2 |
| InChIKey | JJNSQUBKRKWNSO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-imidazol-2-yl)benzamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)benzamide;hydrate?
The IUPAC name of 2-(1H-imidazol-2-yl)benzamide;hydrate (CID 140783933) is 2-(1H-imidazol-2-yl)benzamide;hydrate.
What is the SMILES notation for 2-(1H-imidazol-2-yl)benzamide;hydrate?
The canonical SMILES for 2-(1H-imidazol-2-yl)benzamide;hydrate is NC(=O)c1ccccc1-c1ncc[nH]1.O.
What is the InChIKey of 2-(1H-imidazol-2-yl)benzamide;hydrate?
The InChIKey is JJNSQUBKRKWNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O.H2O/c11-9(14)7-3-1-2-4-8(7)10-12-5-6-13-10;/h1-6H,(H2,11,14)(H,12,13);1H2.
What are the key properties of 2-(1H-imidazol-2-yl)benzamide;hydrate?
2-(1H-imidazol-2-yl)benzamide;hydrate has a molecular weight of 205.22 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)benzamide;hydrate is sourced from PubChem (CID 140783933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).