C39H37N5O3 — CID 140784008
tert-butyl N-[(1S)-3-[3-(1,3,4-oxadiazol-2-yl)-1-tritylpyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate (PubChem CID 140784008) has the molecular formula C39H37N5O3 and a molecular weight of 623.76 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[3-(1,3,4-oxadiazol-2-yl)-1-tritylpyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[3-(1,3,4-oxadiazol-2-yl)-1-tritylpyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 140784008 |
| Molecular Formula | C39H37N5O3 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | tert-butyl N-[(1S)-3-[3-(1,3,4-oxadiazol-2-yl)-1-tritylpyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC=C(c2ccnc3c2c(-c2nnco2)cn3C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C39H37N5O3/c1-38(2,3)47-37(45)42-31-21-13-14-27(24-31)32-22-23-40-35-34(32)33(36-43-41-26-46-36)25-44(35)39(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-12,14-20,22-23,25-26,31H,13,21,24H2,1-3H3,(H,42,45)/t31-/m0/s1 |
| InChIKey | GQIQOIJIMHZFKO-HKBQPEDESA-N |
| XLogP | 8.39 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|