About benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate
benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate (PubChem CID 140784251) has the molecular formula C18H25NO4S
and a molecular weight of 351.47 g/mol. Its IUPAC name is benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate |
| PubChem CID | 140784251 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate |
| SMILES | CC[C@@H]1CN(C(=O)OCc2ccccc2)C[C@@H]1C(=O)C=S(C)(C)=O |
| InChI | InChI=1S/C18H25NO4S/c1-4-15-10-19(11-16(15)17(20)13-24(2,3)22)18(21)23-12-14-8-6-5-7-9-14/h5-9,13,15-16H,4,10-12H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | JBSDYKUHAKGYCH-CVEARBPZSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate?
The IUPAC name of benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate (CID 140784251) is benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate is CC[C@@H]1CN(C(=O)OCc2ccccc2)C[C@@H]1C(=O)C=S(C)(C)=O.
What is the InChIKey of benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate?
The InChIKey is JBSDYKUHAKGYCH-CVEARBPZSA-N. The full InChI is InChI=1S/C18H25NO4S/c1-4-15-10-19(11-16(15)17(20)13-24(2,3)22)18(21)23-12-14-8-6-5-7-9-14/h5-9,13,15-16H,4,10-12H2,1-3H3/t15-,16+/m1/s1.
What are the key properties of benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate?
benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate has a molecular weight of 351.47 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3R,4S)-3-[2-[dimethyl(oxo)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate is sourced from PubChem (CID 140784251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).