C24H33FN7O2+ — CID 140784813
1-[(2R,3S)-4-[ethyl-[3-(4-fluorophenyl)propyl]amino]-3-hydroxybutan-2-yl]-3-[3-(1-methyl-2H-tetrazol-1-ium-5-yl)phenyl]urea (PubChem CID 140784813) has the molecular formula C24H33FN7O2+ and a molecular weight of 470.57 g/mol. Its IUPAC name is 1-[(2R,3S)-4-[ethyl-[3-(4-fluorophenyl)propyl]amino]-3-hydroxybutan-2-yl]-3-[3-(1-methyl-2H-tetrazol-1-ium-5-yl)phenyl]urea.
| Compound Name | 1-[(2R,3S)-4-[ethyl-[3-(4-fluorophenyl)propyl]amino]-3-hydroxybutan-2-yl]-3-[3-(1-methyl-2H-tetrazol-1-ium-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 140784813 |
| Molecular Formula | C24H33FN7O2+ |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-[(2R,3S)-4-[ethyl-[3-(4-fluorophenyl)propyl]amino]-3-hydroxybutan-2-yl]-3-[3-(1-methyl-2H-tetrazol-1-ium-5-yl)phenyl]urea |
| SMILES | CCN(CCCc1ccc(F)cc1)C[C@H](O)[C@@H](C)NC(=O)Nc1cccc(-c2nn[nH][n+]2C)c1 |
| InChI | InChI=1S/C24H32FN7O2/c1-4-32(14-6-7-18-10-12-20(25)13-11-18)16-22(33)17(2)26-24(34)27-21-9-5-8-19(15-21)23-28-29-30-31(23)3/h5,8-13,15,17,22,33H,4,6-7,14,16H2,1-3H3,(H2,26,27,34)/p+1/t17-,22+/m1/s1 |
| InChIKey | PEKYRUYJONXHSA-VGSWGCGISA-O |
| XLogP | 2.26 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|