About carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium)
carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) (PubChem CID 140785584) has the molecular formula C17H18N2O2Y2-4
and a molecular weight of 460.16 g/mol. Its IUPAC name is carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium).
Molecular Properties
| Compound Name | carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) |
| PubChem CID | 140785584 |
| Molecular Formula | C17H18N2O2Y2-4 |
| Molecular Weight | 460.16 g/mol |
| Exact Mass | 459.95 |
| IUPAC Name | carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) |
| SMILES | O=[C-]Nc1ccc(Cc2ccc(N[C-]=O)cc2)cc1.[CH3-].[CH3-].[Y].[Y] |
| InChI | InChI=1S/C15H12N2O2.2CH3.2Y/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;;;;/h1-8H,9H2,(H,16,18)(H,17,19);2*1H3;;/q-2;2*-1;; |
| InChIKey | SLYOMHOHWLCJHD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.16 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium)?
The IUPAC name of carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) (CID 140785584) is carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium).
What is the SMILES notation for carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium)?
The canonical SMILES for carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) is O=[C-]Nc1ccc(Cc2ccc(N[C-]=O)cc2)cc1.[CH3-].[CH3-].[Y].[Y].
What is the InChIKey of carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium)?
The InChIKey is SLYOMHOHWLCJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2.2CH3.2Y/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;;;;/h1-8H,9H2,(H,16,18)(H,17,19);2*1H3;;/q-2;2*-1;;.
What are the key properties of carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium)?
carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) has a molecular weight of 460.16 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[4-[[4-(oxomethylamino)phenyl]methyl]anilino]methanone;bis(yttrium) is sourced from PubChem (CID 140785584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).