C57H50F10N2OSi — CID 140785987
methyl-bis[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140785987) has the molecular formula C57H50F10N2OSi and a molecular weight of 997.11 g/mol. Its IUPAC name is methyl-bis[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | methyl-bis[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140785987 |
| Molecular Formula | C57H50F10N2OSi |
| Molecular Weight | 997.11 g/mol |
| Exact Mass | 996.35 |
| IUPAC Name | methyl-bis[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2c(F)c(F)c(F)c(F)c2F)-c2ccccc2C1[Si](C)(CCCCCCOC(C)(C)C)C1c2ccccc2-c2c1c1cc(C)ccc1n2Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C57H50F10N2OSi/c1-29-19-21-39-35(25-29)41-53(68(39)27-37-43(58)47(62)51(66)48(63)44(37)59)31-15-9-11-17-33(31)55(41)71(6,24-14-8-7-13-23-70-57(3,4)5)56-34-18-12-10-16-32(34)54-42(56)36-26-30(2)20-22-40(36)69(54)28-38-45(60)49(64)52(67)50(65)46(38)61/h9-12,15-22,25-26,55-56H,7-8,13-14,23-24,27-28H2,1-6H3 |
| InChIKey | MYPAOFMLLASJFB-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 19.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.11 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|