C42H42F5NOSi — CID 140785988
1H-inden-1-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane (PubChem CID 140785988) has the molecular formula C42H42F5NOSi and a molecular weight of 699.88 g/mol. Its IUPAC name is 1H-inden-1-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane.
| Compound Name | 1H-inden-1-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane |
|---|---|
| PubChem CID | 140785988 |
| Molecular Formula | C42H42F5NOSi |
| Molecular Weight | 699.88 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | 1H-inden-1-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane |
| SMILES | CC(C)(C)OCCCCCC[Si](C)(C1C=Cc2ccccc21)C1c2ccccc2-c2c1c1ccccc1n2Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C42H42F5NOSi/c1-42(2,3)49-23-13-5-6-14-24-50(4,33-22-21-26-15-7-8-16-27(26)33)41-29-18-10-9-17-28(29)40-34(41)30-19-11-12-20-32(30)48(40)25-31-35(43)37(45)39(47)38(46)36(31)44/h7-12,15-22,33,41H,5-6,13-14,23-25H2,1-4H3 |
| InChIKey | WYXYENGVOPTOEL-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.88 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|