C43H48FNOSi — CID 140785990
[5-[(2-fluorophenyl)methyl]-8-methyl-10H-indeno[1,2-b]indol-10-yl]-(1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140785990) has the molecular formula C43H48FNOSi and a molecular weight of 641.95 g/mol. Its IUPAC name is [5-[(2-fluorophenyl)methyl]-8-methyl-10H-indeno[1,2-b]indol-10-yl]-(1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | [5-[(2-fluorophenyl)methyl]-8-methyl-10H-indeno[1,2-b]indol-10-yl]-(1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140785990 |
| Molecular Formula | C43H48FNOSi |
| Molecular Weight | 641.95 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | [5-[(2-fluorophenyl)methyl]-8-methyl-10H-indeno[1,2-b]indol-10-yl]-(1H-inden-1-yl)-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2ccccc2F)-c2ccccc2C1[Si](C)(CCCCCCOC(C)(C)C)C1C=Cc2ccccc21 |
| InChI | InChI=1S/C43H48FNOSi/c1-30-22-24-38-36(28-30)40-41(45(38)29-32-17-9-13-21-37(32)44)34-19-11-12-20-35(34)42(40)47(5,27-15-7-6-14-26-46-43(2,3)4)39-25-23-31-16-8-10-18-33(31)39/h8-13,16-25,28,39,42H,6-7,14-15,26-27,29H2,1-5H3 |
| InChIKey | CIZBGYYYHYPRHF-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.95 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|