C47H46F5NOSi — CID 140785994
9H-fluoren-9-yl-methyl-[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane (PubChem CID 140785994) has the molecular formula C47H46F5NOSi and a molecular weight of 763.97 g/mol. Its IUPAC name is 9H-fluoren-9-yl-methyl-[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane.
| Compound Name | 9H-fluoren-9-yl-methyl-[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
|---|---|
| PubChem CID | 140785994 |
| Molecular Formula | C47H46F5NOSi |
| Molecular Weight | 763.97 g/mol |
| Exact Mass | 763.33 |
| IUPAC Name | 9H-fluoren-9-yl-methyl-[8-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]-[6-[(2-methylpropan-2-yl)oxy]hexyl]silane |
| SMILES | Cc1ccc2c(c1)c1c(n2Cc2c(F)c(F)c(F)c(F)c2F)-c2ccccc2C1[Si](C)(CCCCCCOC(C)(C)C)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C47H46F5NOSi/c1-28-22-23-37-35(26-28)38-44(53(37)27-36-39(48)41(50)43(52)42(51)40(36)49)31-18-10-13-21-34(31)46(38)55(5,25-15-7-6-14-24-54-47(2,3)4)45-32-19-11-8-16-29(32)30-17-9-12-20-33(30)45/h8-13,16-23,26,45-46H,6-7,14-15,24-25,27H2,1-5H3 |
| InChIKey | UGLHQOXURMWVAI-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.97 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|