C46H44F5NOSi — CID 140785995
9H-fluoren-9-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane (PubChem CID 140785995) has the molecular formula C46H44F5NOSi and a molecular weight of 749.94 g/mol. Its IUPAC name is 9H-fluoren-9-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane.
| Compound Name | 9H-fluoren-9-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane |
|---|---|
| PubChem CID | 140785995 |
| Molecular Formula | C46H44F5NOSi |
| Molecular Weight | 749.94 g/mol |
| Exact Mass | 749.31 |
| IUPAC Name | 9H-fluoren-9-yl-methyl-[6-[(2-methylpropan-2-yl)oxy]hexyl]-[5-[(2,3,4,5,6-pentafluorophenyl)methyl]-10H-indeno[1,2-b]indol-10-yl]silane |
| SMILES | CC(C)(C)OCCCCCC[Si](C)(C1c2ccccc2-c2ccccc21)C1c2ccccc2-c2c1c1ccccc1n2Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C46H44F5NOSi/c1-46(2,3)53-25-15-5-6-16-26-54(4,44-31-20-10-7-17-28(31)29-18-8-11-21-32(29)44)45-33-22-12-9-19-30(33)43-37(45)34-23-13-14-24-36(34)52(43)27-35-38(47)40(49)42(51)41(50)39(35)48/h7-14,17-24,44-45H,5-6,15-16,25-27H2,1-4H3 |
| InChIKey | GFDSRPQDYOTBDV-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.94 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|