C12H19F5O2Si — CID 140786998
5-[dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-3-methylpent-1-yn-3-ol (PubChem CID 140786998) has the molecular formula C12H19F5O2Si and a molecular weight of 318.36 g/mol. Its IUPAC name is 5-[dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-3-methylpent-1-yn-3-ol.
| Compound Name | 5-[dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-3-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 140786998 |
| Molecular Formula | C12H19F5O2Si |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 5-[dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-3-methylpent-1-yn-3-ol |
| SMILES | C#CC(C)(O)CCO[Si](C)(C)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H19F5O2Si/c1-5-10(2,18)6-8-19-20(3,4)9-7-11(13,14)12(15,16)17/h1,18H,6-9H2,2-4H3 |
| InChIKey | DWWZIBWQNJEXLH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|