C23H46N2O6Si — CID 140787460
N-[4-(aminomethyl)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide (PubChem CID 140787460) has the molecular formula C23H46N2O6Si and a molecular weight of 474.72 g/mol. Its IUPAC name is N-[4-(aminomethyl)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide.
| Compound Name | N-[4-(aminomethyl)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
|---|---|
| PubChem CID | 140787460 |
| Molecular Formula | C23H46N2O6Si |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | N-[4-(aminomethyl)-6-[6-[tert-butyl(dimethyl)silyl]oxyhexoxy]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
| SMILES | CC(=O)NC1C(OCCCCCCO[Si](C)(C)C(C)(C)C)OC(CN)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C23H46N2O6Si/c1-16(26)25-18-20-19(30-23(5,6)31-20)17(15-24)29-21(18)27-13-11-9-10-12-14-28-32(7,8)22(2,3)4/h17-21H,9-15,24H2,1-8H3,(H,25,26) |
| InChIKey | WMRNPFQTSDTITB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|