C26H21ClF3NO7 — CID 140787843
methyl (1R,10S,11S)-5-chloro-1,12,12-trihydroxy-3-methoxy-10-phenyl-9-[4-(trifluoromethyl)phenyl]-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate (PubChem CID 140787843) has the molecular formula C26H21ClF3NO7 and a molecular weight of 551.90 g/mol. Its IUPAC name is methyl (1R,10S,11S)-5-chloro-1,12,12-trihydroxy-3-methoxy-10-phenyl-9-[4-(trifluoromethyl)phenyl]-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate.
| Compound Name | methyl (1R,10S,11S)-5-chloro-1,12,12-trihydroxy-3-methoxy-10-phenyl-9-[4-(trifluoromethyl)phenyl]-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 140787843 |
| Molecular Formula | C26H21ClF3NO7 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | methyl (1R,10S,11S)-5-chloro-1,12,12-trihydroxy-3-methoxy-10-phenyl-9-[4-(trifluoromethyl)phenyl]-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccccc2)C2(c3ccc(C(F)(F)F)cc3)Oc3cc(Cl)nc(OC)c3[C@@]1(O)C2(O)O |
| InChI | InChI=1S/C26H21ClF3NO7/c1-36-21-19-16(12-17(27)31-21)38-24(14-8-10-15(11-9-14)25(28,29)30)18(13-6-4-3-5-7-13)20(22(32)37-2)23(19,33)26(24,34)35/h3-12,18,20,33-35H,1-2H3/t18-,20-,23+,24?/m1/s1 |
| InChIKey | HPQXVDXJCGPYHC-WKXYFPTFSA-N |
| XLogP | 3.51 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|