About 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one
5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one (PubChem CID 140788501) has the molecular formula C16H28O5Si
and a molecular weight of 328.48 g/mol. Its IUPAC name is 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one.
Molecular Properties
| Compound Name | 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one |
| PubChem CID | 140788501 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one |
| SMILES | CCO[Si](OCC)(OCC)C1CC2CC1CC21CCOC1=O |
| InChI | InChI=1S/C16H28O5Si/c1-4-19-22(20-5-2,21-6-3)14-10-13-9-12(14)11-16(13)7-8-18-15(16)17/h12-14H,4-11H2,1-3H3 |
| InChIKey | IRDBNRQYWIVTBP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one?
The IUPAC name of 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one (CID 140788501) is 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one.
What is the SMILES notation for 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one?
The canonical SMILES for 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one is CCO[Si](OCC)(OCC)C1CC2CC1CC21CCOC1=O.
What is the InChIKey of 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one?
The InChIKey is IRDBNRQYWIVTBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O5Si/c1-4-19-22(20-5-2,21-6-3)14-10-13-9-12(14)11-16(13)7-8-18-15(16)17/h12-14H,4-11H2,1-3H3.
What are the key properties of 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one?
5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one has a molecular weight of 328.48 g/mol, XLogP of 2.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-triethoxysilylspiro[bicyclo[2.2.1]heptane-2,3'-oxolane]-2'-one is sourced from PubChem (CID 140788501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).