About CID 140788686
CID 140788686 (PubChem CID 140788686) has the molecular formula C15H17OSi
and a molecular weight of 241.39 g/mol.
Molecular Properties
| Compound Name | CID 140788686 |
| PubChem CID | 140788686 |
| Molecular Formula | C15H17OSi |
| Molecular Weight | 241.39 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | — |
| SMILES | COC(C)c1ccc2cc(CC[Si])ccc2c1 |
| InChI | InChI=1S/C15H17OSi/c1-11(16-2)13-5-6-14-9-12(7-8-17)3-4-15(14)10-13/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | YXFCKCMEQUBISP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140788686 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140788686?
The IUPAC name of CID 140788686 (CID 140788686) is not available.
What is the SMILES notation for CID 140788686?
The canonical SMILES for CID 140788686 is COC(C)c1ccc2cc(CC[Si])ccc2c1.
What is the InChIKey of CID 140788686?
The InChIKey is YXFCKCMEQUBISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17OSi/c1-11(16-2)13-5-6-14-9-12(7-8-17)3-4-15(14)10-13/h3-6,9-11H,7-8H2,1-2H3.
What are the key properties of CID 140788686?
CID 140788686 has a molecular weight of 241.39 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140788686 is sourced from PubChem (CID 140788686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).