C25H27N — CID 140789925
5,5,8,8-tetramethyl-3-(3-phenylphenyl)-6,7-dihydroisoquinoline (PubChem CID 140789925) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is 5,5,8,8-tetramethyl-3-(3-phenylphenyl)-6,7-dihydroisoquinoline.
| Compound Name | 5,5,8,8-tetramethyl-3-(3-phenylphenyl)-6,7-dihydroisoquinoline |
|---|---|
| PubChem CID | 140789925 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 5,5,8,8-tetramethyl-3-(3-phenylphenyl)-6,7-dihydroisoquinoline |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(-c4ccccc4)c3)ncc21 |
| InChI | InChI=1S/C25H27N/c1-24(2)13-14-25(3,4)22-17-26-23(16-21(22)24)20-12-8-11-19(15-20)18-9-6-5-7-10-18/h5-12,15-17H,13-14H2,1-4H3 |
| InChIKey | AUMWZWLJDGSDGL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |