C36H34IrN2-2 — CID 140789984
iridium;2-phenylpyridine;5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine (PubChem CID 140789984) has the molecular formula C36H34IrN2-2 and a molecular weight of 686.90 g/mol. Its IUPAC name is iridium;2-phenylpyridine;5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine.
| Compound Name | iridium;2-phenylpyridine;5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 140789984 |
| Molecular Formula | C36H34IrN2-2 |
| Molecular Weight | 686.90 g/mol |
| Exact Mass | 687.24 |
| IUPAC Name | iridium;2-phenylpyridine;5-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3ccc(-c4ccccc4)cn3)[c-]cc21.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C25H26N.C11H8N.Ir/c1-24(2)14-15-25(3,4)22-16-19(10-12-21(22)24)23-13-11-20(17-26-23)18-8-6-5-7-9-18;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-9,11-13,16-17H,14-15H2,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | HYRYVVCFTJGVDC-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.90 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|