C46H43IrN2- — CID 140790062
9,9-dimethyl-N-(4-phenylphenyl)-N-[3-(5,5,8,8-tetramethyl-6,7-dihydroisoquinolin-3-yl)benzene-4-id-1-yl]fluoren-2-amine;iridium (PubChem CID 140790062) has the molecular formula C46H43IrN2- and a molecular weight of 816.08 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-phenylphenyl)-N-[3-(5,5,8,8-tetramethyl-6,7-dihydroisoquinolin-3-yl)benzene-4-id-1-yl]fluoren-2-amine;iridium.
| Compound Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[3-(5,5,8,8-tetramethyl-6,7-dihydroisoquinolin-3-yl)benzene-4-id-1-yl]fluoren-2-amine;iridium |
|---|---|
| PubChem CID | 140790062 |
| Molecular Formula | C46H43IrN2- |
| Molecular Weight | 816.08 g/mol |
| Exact Mass | 816.31 |
| IUPAC Name | 9,9-dimethyl-N-(4-phenylphenyl)-N-[3-(5,5,8,8-tetramethyl-6,7-dihydroisoquinolin-3-yl)benzene-4-id-1-yl]fluoren-2-amine;iridium |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3[c-]ccc(N(c4ccc(-c5ccccc5)cc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)ncc21.[Ir] |
| InChI | InChI=1S/C46H43N2.Ir/c1-44(2)25-26-45(3,4)42-30-47-43(29-41(42)44)33-15-12-16-35(27-33)48(34-21-19-32(20-22-34)31-13-8-7-9-14-31)36-23-24-38-37-17-10-11-18-39(37)46(5,6)40(38)28-36;/h7-14,16-24,27-30H,25-26H2,1-6H3;/q-1; |
| InChIKey | RHOUIRLUYKTHHM-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.08 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|