About CID 140790246
CID 140790246 (PubChem CID 140790246) has the molecular formula C34H23BN3O2
and a molecular weight of 516.39 g/mol.
Molecular Properties
| Compound Name | CID 140790246 |
| PubChem CID | 140790246 |
| Molecular Formula | C34H23BN3O2 |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2cc(-c3ccccn3)cc(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C34H23BN3O2/c39-35-40-28-15-16-34-30(22-28)29-7-1-2-10-33(29)38(34)27-13-11-23(12-14-27)24-19-25(31-8-3-5-17-36-31)21-26(20-24)32-9-4-6-18-37-32/h1-22,39H |
| InChIKey | SKEKKRFUKQTOLB-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140790246 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140790246?
The IUPAC name of CID 140790246 (CID 140790246) is not available.
What is the SMILES notation for CID 140790246?
The canonical SMILES for CID 140790246 is O[B]Oc1ccc2c(c1)c1ccccc1n2-c1ccc(-c2cc(-c3ccccn3)cc(-c3ccccn3)c2)cc1.
What is the InChIKey of CID 140790246?
The InChIKey is SKEKKRFUKQTOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H23BN3O2/c39-35-40-28-15-16-34-30(22-28)29-7-1-2-10-33(29)38(34)27-13-11-23(12-14-27)24-19-25(31-8-3-5-17-36-31)21-26(20-24)32-9-4-6-18-37-32/h1-22,39H.
What are the key properties of CID 140790246?
CID 140790246 has a molecular weight of 516.39 g/mol, XLogP of 7.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140790246 is sourced from PubChem (CID 140790246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).