C28H19BN3O2 — CID 140790252
CID 140790252 (PubChem CID 140790252) has the molecular formula C28H19BN3O2 and a molecular weight of 440.29 g/mol.
| Compound Name | CID 140790252 |
|---|---|
| PubChem CID | 140790252 |
| Molecular Formula | C28H19BN3O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc2c(c1)c1ccccc1n2-c1cnc(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H19BN3O2/c33-29-34-21-15-16-25-23(17-21)22-13-7-8-14-24(22)32(25)26-18-30-28(20-11-5-2-6-12-20)31-27(26)19-9-3-1-4-10-19/h1-18,33H |
| InChIKey | QEACENBZXTTWFI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|