C46H31N3 — CID 140790446
3-[9-(9,9-dimethylfluoren-1-yl)carbazol-3-yl]-9-(3-isocyanophenyl)carbazole (PubChem CID 140790446) has the molecular formula C46H31N3 and a molecular weight of 625.78 g/mol. Its IUPAC name is 3-[9-(9,9-dimethylfluoren-1-yl)carbazol-3-yl]-9-(3-isocyanophenyl)carbazole.
| Compound Name | 3-[9-(9,9-dimethylfluoren-1-yl)carbazol-3-yl]-9-(3-isocyanophenyl)carbazole |
|---|---|
| PubChem CID | 140790446 |
| Molecular Formula | C46H31N3 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 3-[9-(9,9-dimethylfluoren-1-yl)carbazol-3-yl]-9-(3-isocyanophenyl)carbazole |
| SMILES | [C-]#[N+]c1cccc(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4ccccc4n5-c4cccc5c4C(C)(C)c4ccccc4-5)ccc32)c1 |
| InChI | InChI=1S/C46H31N3/c1-46(2)39-18-7-4-14-33(39)36-17-11-21-44(45(36)46)49-41-20-9-6-16-35(41)38-27-30(23-25-43(38)49)29-22-24-42-37(26-29)34-15-5-8-19-40(34)48(42)32-13-10-12-31(28-32)47-3/h4-28H,1-2H3 |
| InChIKey | VDMXFWNCYZRFNR-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|