C20H22ClFN5+ — CID 140790720
[3-chloro-5-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine (PubChem CID 140790720) has the molecular formula C20H22ClFN5+ and a molecular weight of 386.88 g/mol. Its IUPAC name is [3-chloro-5-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine.
| Compound Name | [3-chloro-5-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine |
|---|---|
| PubChem CID | 140790720 |
| Molecular Formula | C20H22ClFN5+ |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [3-chloro-5-fluoro-4-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]phenyl]-piperazin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1cc(F)c(Cn2ccc3c[n+](C)ccc32)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C20H22ClFN5/c1-25-6-3-19-14(12-25)2-7-27(19)13-16-17(21)10-15(11-18(16)22)20(23)26-8-4-24-5-9-26/h2-3,6-7,10-12,23-24H,4-5,8-9,13H2,1H3/q+1/b23-20- |
| InChIKey | ZOXIJKKSRLKCDC-ATJXCDBQSA-N |
| XLogP | 2.54 |
| TPSA | 47.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|