About 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide
5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide (PubChem CID 140790751) has the molecular formula C20H19N4S+
and a molecular weight of 347.47 g/mol. Its IUPAC name is 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide.
Molecular Properties
| Compound Name | 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide |
| PubChem CID | 140790751 |
| Molecular Formula | C20H19N4S+ |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide |
| SMILES | C[n+]1ccc2c(ccn2Cc2cc(/C(N)=N/c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C20H19N4S/c1-23-9-8-19-15(12-23)7-10-24(19)13-18-11-16(14-25-18)20(21)22-17-5-3-2-4-6-17/h2-12,14H,13H2,1H3,(H2,21,22)/q+1 |
| InChIKey | LMQZGIHTOCEBCZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide?
The IUPAC name of 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide (CID 140790751) is 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide.
What is the SMILES notation for 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide?
The canonical SMILES for 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide is C[n+]1ccc2c(ccn2Cc2cc(/C(N)=N/c3ccccc3)cs2)c1.
What is the InChIKey of 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide?
The InChIKey is LMQZGIHTOCEBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N4S/c1-23-9-8-19-15(12-23)7-10-24(19)13-18-11-16(14-25-18)20(21)22-17-5-3-2-4-6-17/h2-12,14H,13H2,1H3,(H2,21,22)/q+1.
What are the key properties of 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide?
5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide has a molecular weight of 347.47 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methylpyrrolo[3,2-c]pyridin-5-ium-1-yl)methyl]-N'-phenylthiophene-3-carboximidamide is sourced from PubChem (CID 140790751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).