About (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate
(2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 140790780) has the molecular formula C7H9N3O5S
and a molecular weight of 247.23 g/mol. Its IUPAC name is (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| PubChem CID | 140790780 |
| Molecular Formula | C7H9N3O5S |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | [C-]#[N+]C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C7H9N3O5S/c1-8-6-3-2-5-4-9(6)7(11)10(5)15-16(12,13)14/h5-6H,2-4H2,(H,12,13,14) |
| InChIKey | KMLPQWWNADCWBM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate?
The IUPAC name of (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (CID 140790780) is (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
What is the SMILES notation for (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate?
The canonical SMILES for (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate is [C-]#[N+]C1CCC2CN1C(=O)N2OS(=O)(=O)O.
What is the InChIKey of (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate?
The InChIKey is KMLPQWWNADCWBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O5S/c1-8-6-3-2-5-4-9(6)7(11)10(5)15-16(12,13)14/h5-6H,2-4H2,(H,12,13,14).
What are the key properties of (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate?
(2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate has a molecular weight of 247.23 g/mol, XLogP of -0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate is sourced from PubChem (CID 140790780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).