About [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate
[2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate (PubChem CID 140791716) has the molecular formula C13H21O8P
and a molecular weight of 336.28 g/mol. Its IUPAC name is [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate.
Molecular Properties
| Compound Name | [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate |
| PubChem CID | 140791716 |
| Molecular Formula | C13H21O8P |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate |
| SMILES | COP(=O)(OOC(=O)C(C)=C(C)C)OOC(=O)C(C)=C(C)C |
| InChI | InChI=1S/C13H21O8P/c1-8(2)10(5)12(14)18-20-22(16,17-7)21-19-13(15)11(6)9(3)4/h1-7H3 |
| InChIKey | PRXDIKDOGZFEEO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate?
The IUPAC name of [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate (CID 140791716) is [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate.
What is the SMILES notation for [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate?
The canonical SMILES for [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate is COP(=O)(OOC(=O)C(C)=C(C)C)OOC(=O)C(C)=C(C)C.
What is the InChIKey of [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate?
The InChIKey is PRXDIKDOGZFEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21O8P/c1-8(2)10(5)12(14)18-20-22(16,17-7)21-19-13(15)11(6)9(3)4/h1-7H3.
What are the key properties of [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate?
[2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate has a molecular weight of 336.28 g/mol, XLogP of 3.40, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-dimethylbut-2-enoylperoxy(methoxy)phosphoryl] 2,3-dimethylbut-2-eneperoxoate is sourced from PubChem (CID 140791716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).