C35H35N5O2 — CID 140791892
methyl 6-[3-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-3,9-diazaspiro[5.5]undecan-9-yl]pyridine-3-carboxylate (PubChem CID 140791892) has the molecular formula C35H35N5O2 and a molecular weight of 557.70 g/mol. Its IUPAC name is methyl 6-[3-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-3,9-diazaspiro[5.5]undecan-9-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[3-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-3,9-diazaspiro[5.5]undecan-9-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140791892 |
| Molecular Formula | C35H35N5O2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | methyl 6-[3-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-3,9-diazaspiro[5.5]undecan-9-yl]pyridine-3-carboxylate |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(C4CC4)c(N4CCC5(CCN(c6ccc(C(=O)OC)cn6)CC5)CC4)cnc23)cc1 |
| InChI | InChI=1S/C35H35N5O2/c1-36-27-11-8-24(9-12-27)28-4-3-5-29-32(25-6-7-25)30(23-38-33(28)29)39-18-14-35(15-19-39)16-20-40(21-17-35)31-13-10-26(22-37-31)34(41)42-2/h3-5,8-13,22-23,25H,6-7,14-21H2,2H3 |
| InChIKey | DAKVAZPMDGNMML-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|