C23H28BNO3 — CID 140792052
2-[4-[[4-(2-isocyanopropan-2-yl)phenyl]methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140792052) has the molecular formula C23H28BNO3 and a molecular weight of 377.29 g/mol. Its IUPAC name is 2-[4-[[4-(2-isocyanopropan-2-yl)phenyl]methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[[4-(2-isocyanopropan-2-yl)phenyl]methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140792052 |
| Molecular Formula | C23H28BNO3 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[4-[[4-(2-isocyanopropan-2-yl)phenyl]methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [C-]#[N+]C(C)(C)c1ccc(COc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C23H28BNO3/c1-21(2,25-7)18-10-8-17(9-11-18)16-26-20-14-12-19(13-15-20)24-27-22(3,4)23(5,6)28-24/h8-15H,16H2,1-6H3 |
| InChIKey | YZEZYXPJUGRDLA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|