C17H30N6O3SSi — CID 140792410
(2S)-2-[(1S)-2-(2-amino-1,3-thiazol-5-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid (PubChem CID 140792410) has the molecular formula C17H30N6O3SSi and a molecular weight of 426.62 g/mol. Its IUPAC name is (2S)-2-[(1S)-2-(2-amino-1,3-thiazol-5-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid.
| Compound Name | (2S)-2-[(1S)-2-(2-amino-1,3-thiazol-5-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
|---|---|
| PubChem CID | 140792410 |
| Molecular Formula | C17H30N6O3SSi |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (2S)-2-[(1S)-2-(2-amino-1,3-thiazol-5-yl)-1-[1-(2-trimethylsilylethoxymethyl)tetrazol-5-yl]ethyl]pentanoic acid |
| SMILES | CCC[C@H](C(=O)O)[C@H](Cc1cnc(N)s1)c1nnnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H30N6O3SSi/c1-5-6-13(16(24)25)14(9-12-10-19-17(18)27-12)15-20-21-22-23(15)11-26-7-8-28(2,3)4/h10,13-14H,5-9,11H2,1-4H3,(H2,18,19)(H,24,25)/t13-,14-/m0/s1 |
| InChIKey | DWYDKTKMZVLRSM-KBPBESRZSA-N |
| XLogP | 2.85 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|