C36H44Cl2N2O9 — CID 140792910
N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-2,3,4,5,6-pentahydroxy-N-(2-hydroxyethyl)hexanamide (PubChem CID 140792910) has the molecular formula C36H44Cl2N2O9 and a molecular weight of 719.66 g/mol. Its IUPAC name is N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-2,3,4,5,6-pentahydroxy-N-(2-hydroxyethyl)hexanamide.
| Compound Name | N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-2,3,4,5,6-pentahydroxy-N-(2-hydroxyethyl)hexanamide |
|---|---|
| PubChem CID | 140792910 |
| Molecular Formula | C36H44Cl2N2O9 |
| Molecular Weight | 719.66 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-2,3,4,5,6-pentahydroxy-N-(2-hydroxyethyl)hexanamide |
| SMILES | O=C(C(O)C(O)C(O)C(O)CO)N(CCO)CCCCc1cc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C36H44Cl2N2O9/c37-28-18-23(21-48-36(11-12-36)27-19-39-13-10-25(27)26-6-1-2-7-31(26)49-24-8-9-24)29(38)17-22(28)5-3-4-14-40(15-16-41)35(47)34(46)33(45)32(44)30(43)20-42/h1-2,6-7,10,13,17-19,24,30,32-34,41-46H,3-5,8-9,11-12,14-16,20-21H2 |
| InChIKey | ZJXBRDCLXHWUOT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 173.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|