C36H44Cl2N2O8 — CID 140793063
N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 140793063) has the molecular formula C36H44Cl2N2O8 and a molecular weight of 703.66 g/mol. Its IUPAC name is N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 140793063 |
| Molecular Formula | C36H44Cl2N2O8 |
| Molecular Weight | 703.66 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | N-[4-[2,5-dichloro-4-[[1-[4-(2-cyclopropyloxyphenyl)-3-pyridinyl]cyclopropyl]oxymethyl]phenyl]butyl]-N-ethyl-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CCN(CCCCc1cc(Cl)c(COC2(c3cnccc3-c3ccccc3OC3CC3)CC2)cc1Cl)C(=O)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C36H44Cl2N2O8/c1-2-40(35(46)34(45)33(44)32(43)30(42)20-41)16-6-5-7-22-17-29(38)23(18-28(22)37)21-47-36(13-14-36)27-19-39-15-12-25(27)26-8-3-4-9-31(26)48-24-10-11-24/h3-4,8-9,12,15,17-19,24,30,32-34,41-45H,2,5-7,10-11,13-14,16,20-21H2,1H3 |
| InChIKey | LWHIEQNTLCSDLW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 152.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|