C43H39BN2O2 — CID 140793169
4-[3-(9,9-dimethylfluoren-2-yl)phenyl]-6-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 140793169) has the molecular formula C43H39BN2O2 and a molecular weight of 626.61 g/mol. Its IUPAC name is 4-[3-(9,9-dimethylfluoren-2-yl)phenyl]-6-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 4-[3-(9,9-dimethylfluoren-2-yl)phenyl]-6-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 140793169 |
| Molecular Formula | C43H39BN2O2 |
| Molecular Weight | 626.61 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | 4-[3-(9,9-dimethylfluoren-2-yl)phenyl]-6-phenyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5cccc(B6OC(C)(C)C(C)(C)O6)c5)n4)c3)cc21 |
| InChI | InChI=1S/C43H39BN2O2/c1-41(2)36-21-11-10-20-34(36)35-23-22-30(26-37(35)41)29-16-12-17-31(24-29)39-27-38(28-14-8-7-9-15-28)45-40(46-39)32-18-13-19-33(25-32)44-47-42(3,4)43(5,6)48-44/h7-27H,1-6H3 |
| InChIKey | FOWHEFRTCYKLPU-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.61 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|