C27H34BFN2O6 — CID 140793605
methyl 7-fluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate (PubChem CID 140793605) has the molecular formula C27H34BFN2O6 and a molecular weight of 512.39 g/mol. Its IUPAC name is methyl 7-fluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate.
| Compound Name | methyl 7-fluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 140793605 |
| Molecular Formula | C27H34BFN2O6 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | methyl 7-fluoro-2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate |
| SMILES | COC(=O)c1c(F)ccc2c1CN(c1ccc(B3OC(C)(C)C(C)(C)O3)c(C(=O)OC(C)(C)C)n1)CC2 |
| InChI | InChI=1S/C27H34BFN2O6/c1-25(2,3)35-24(33)22-18(28-36-26(4,5)27(6,7)37-28)10-12-20(30-22)31-14-13-16-9-11-19(29)21(17(16)15-31)23(32)34-8/h9-12H,13-15H2,1-8H3 |
| InChIKey | VFZDUBUNRVCWCB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|