About 9-methyldeca-1,3,5,7-tetrayne
9-methyldeca-1,3,5,7-tetrayne (PubChem CID 140793700) has the molecular formula C11H8
and a molecular weight of 140.18 g/mol. Its IUPAC name is 9-methyldeca-1,3,5,7-tetrayne.
Molecular Properties
| Compound Name | 9-methyldeca-1,3,5,7-tetrayne |
| PubChem CID | 140793700 |
| Molecular Formula | C11H8 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 9-methyldeca-1,3,5,7-tetrayne |
| SMILES | C#CC#CC#CC#CC(C)C |
| InChI | InChI=1S/C11H8/c1-4-5-6-7-8-9-10-11(2)3/h1,11H,2-3H3 |
| InChIKey | IDXURSRQOHWPKJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-methyldeca-1,3,5,7-tetrayne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyldeca-1,3,5,7-tetrayne?
The IUPAC name of 9-methyldeca-1,3,5,7-tetrayne (CID 140793700) is 9-methyldeca-1,3,5,7-tetrayne.
What is the SMILES notation for 9-methyldeca-1,3,5,7-tetrayne?
The canonical SMILES for 9-methyldeca-1,3,5,7-tetrayne is C#CC#CC#CC#CC(C)C.
What is the InChIKey of 9-methyldeca-1,3,5,7-tetrayne?
The InChIKey is IDXURSRQOHWPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8/c1-4-5-6-7-8-9-10-11(2)3/h1,11H,2-3H3.
What are the key properties of 9-methyldeca-1,3,5,7-tetrayne?
9-methyldeca-1,3,5,7-tetrayne has a molecular weight of 140.18 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyldeca-1,3,5,7-tetrayne is sourced from PubChem (CID 140793700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).