C44H24N4O — CID 140793986
2-([1]benzofuro[3,2-a]carbazol-12-yl)-3-[4-(3-isocyanocarbazol-9-yl)phenyl]benzonitrile (PubChem CID 140793986) has the molecular formula C44H24N4O and a molecular weight of 624.70 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-a]carbazol-12-yl)-3-[4-(3-isocyanocarbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 2-([1]benzofuro[3,2-a]carbazol-12-yl)-3-[4-(3-isocyanocarbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140793986 |
| Molecular Formula | C44H24N4O |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | 2-([1]benzofuro[3,2-a]carbazol-12-yl)-3-[4-(3-isocyanocarbazol-9-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2cccc(C#N)c2-n2c3ccccc3c3ccc4oc5ccccc5c4c32)cc1 |
| InChI | InChI=1S/C44H24N4O/c1-46-29-19-23-39-36(25-29)33-11-3-5-14-37(33)47(39)30-20-17-27(18-21-30)31-13-8-9-28(26-45)43(31)48-38-15-6-2-10-32(38)34-22-24-41-42(44(34)48)35-12-4-7-16-40(35)49-41/h2-25H |
| InChIKey | LLNVHGSPMYWPGB-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 51.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|