About 2-heptylundecyl 2-(2-methylphenyl)propanoate
2-heptylundecyl 2-(2-methylphenyl)propanoate (PubChem CID 140794907) has the molecular formula C28H48O2
and a molecular weight of 416.69 g/mol. Its IUPAC name is 2-heptylundecyl 2-(2-methylphenyl)propanoate.
Molecular Properties
| Compound Name | 2-heptylundecyl 2-(2-methylphenyl)propanoate |
| PubChem CID | 140794907 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | 2-heptylundecyl 2-(2-methylphenyl)propanoate |
| SMILES | CCCCCCCCCC(CCCCCCC)COC(=O)C(C)c1ccccc1C |
| InChI | InChI=1S/C28H48O2/c1-5-7-9-11-12-14-16-21-26(20-15-13-10-8-6-2)23-30-28(29)25(4)27-22-18-17-19-24(27)3/h17-19,22,25-26H,5-16,20-21,23H2,1-4H3 |
| InChIKey | UPGVWACQFGOGNV-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptylundecyl 2-(2-methylphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptylundecyl 2-(2-methylphenyl)propanoate?
The IUPAC name of 2-heptylundecyl 2-(2-methylphenyl)propanoate (CID 140794907) is 2-heptylundecyl 2-(2-methylphenyl)propanoate.
What is the SMILES notation for 2-heptylundecyl 2-(2-methylphenyl)propanoate?
The canonical SMILES for 2-heptylundecyl 2-(2-methylphenyl)propanoate is CCCCCCCCCC(CCCCCCC)COC(=O)C(C)c1ccccc1C.
What is the InChIKey of 2-heptylundecyl 2-(2-methylphenyl)propanoate?
The InChIKey is UPGVWACQFGOGNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H48O2/c1-5-7-9-11-12-14-16-21-26(20-15-13-10-8-6-2)23-30-28(29)25(4)27-22-18-17-19-24(27)3/h17-19,22,25-26H,5-16,20-21,23H2,1-4H3.
What are the key properties of 2-heptylundecyl 2-(2-methylphenyl)propanoate?
2-heptylundecyl 2-(2-methylphenyl)propanoate has a molecular weight of 416.69 g/mol, XLogP of 8.76, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptylundecyl 2-(2-methylphenyl)propanoate is sourced from PubChem (CID 140794907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).