C18H29N — CID 140795334
(2S,4aR)-2-isocyano-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene (PubChem CID 140795334) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (2S,4aR)-2-isocyano-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene.
| Compound Name | (2S,4aR)-2-isocyano-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 140795334 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (2S,4aR)-2-isocyano-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | [C-]#[N+][C@H]1CC[C@@]2(C)C(=CCC(C(C)C)C2C(C)C)C1 |
| InChI | InChI=1S/C18H29N/c1-12(2)16-8-7-14-11-15(19-6)9-10-18(14,5)17(16)13(3)4/h7,12-13,15-17H,8-11H2,1-5H3/t15-,16?,17?,18-/m0/s1 |
| InChIKey | MPZRNJJMMYWALX-BFWZDYSYSA-N |
| XLogP | 5.34 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|