C23H37F3N2O4S — CID 140795818
N-ethyl-N-[3-[(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)methyl]cyclohexyl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide (PubChem CID 140795818) has the molecular formula C23H37F3N2O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-ethyl-N-[3-[(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)methyl]cyclohexyl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide.
| Compound Name | N-ethyl-N-[3-[(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)methyl]cyclohexyl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 140795818 |
| Molecular Formula | C23H37F3N2O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | N-ethyl-N-[3-[(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-3-yl)methyl]cyclohexyl]-3-(trifluoromethyl)cyclohexane-1-sulfonamide |
| SMILES | CCN(C1CCCC(CN2C(=O)OC3CCCCC32)C1)S(=O)(=O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C23H37F3N2O4S/c1-2-28(33(30,31)19-10-6-8-17(14-19)23(24,25)26)18-9-5-7-16(13-18)15-27-20-11-3-4-12-21(20)32-22(27)29/h16-21H,2-15H2,1H3 |
| InChIKey | NTGNLCYLQIWKDJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |