C38H33BN4O2 — CID 140796909
4,6-bis(5-phenyl-2-pyridinyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 140796909) has the molecular formula C38H33BN4O2 and a molecular weight of 588.52 g/mol. Its IUPAC name is 4,6-bis(5-phenyl-2-pyridinyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 4,6-bis(5-phenyl-2-pyridinyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 140796909 |
| Molecular Formula | C38H33BN4O2 |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 4,6-bis(5-phenyl-2-pyridinyl)-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccc(-c5ccccc5)cn4)cc(-c4ccc(-c5ccccc5)cn4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C38H33BN4O2/c1-37(2)38(3,4)45-39(44-37)31-19-15-28(16-20-31)36-42-34(32-21-17-29(24-40-32)26-11-7-5-8-12-26)23-35(43-36)33-22-18-30(25-41-33)27-13-9-6-10-14-27/h5-25H,1-4H3 |
| InChIKey | WVVGKSNFSWWCQO-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|