C37H30BN3O2S — CID 140796915
2-naphtho[2,1-b][1]benzothiol-10-yl-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 140796915) has the molecular formula C37H30BN3O2S and a molecular weight of 591.55 g/mol. Its IUPAC name is 2-naphtho[2,1-b][1]benzothiol-10-yl-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-naphtho[2,1-b][1]benzothiol-10-yl-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140796915 |
| Molecular Formula | C37H30BN3O2S |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 2-naphtho[2,1-b][1]benzothiol-10-yl-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc5sc6ccc7ccccc7c6c5c4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C37H30BN3O2S/c1-36(2)37(3,4)43-38(42-36)27-18-14-25(15-19-27)34-39-33(24-11-6-5-7-12-24)40-35(41-34)26-17-20-30-29(22-26)32-28-13-9-8-10-23(28)16-21-31(32)44-30/h5-22H,1-4H3 |
| InChIKey | GAUAGPVOKPLMGB-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|