C37H32BN5O2 — CID 140796938
2,4-bis(6-phenyl-3-pyridinyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 140796938) has the molecular formula C37H32BN5O2 and a molecular weight of 589.51 g/mol. Its IUPAC name is 2,4-bis(6-phenyl-3-pyridinyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(6-phenyl-3-pyridinyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140796938 |
| Molecular Formula | C37H32BN5O2 |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 2,4-bis(6-phenyl-3-pyridinyl)-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4ccc(-c5ccccc5)nc4)nc(-c4ccc(-c5ccccc5)nc4)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C37H32BN5O2/c1-36(2)37(3,4)45-38(44-36)30-19-15-27(16-20-30)33-41-34(28-17-21-31(39-23-28)25-11-7-5-8-12-25)43-35(42-33)29-18-22-32(40-24-29)26-13-9-6-10-14-26/h5-24H,1-4H3 |
| InChIKey | WLUXHMMGHKVKRW-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|