C34H29BN4O2 — CID 140796953
5-[6-pyridin-3-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-4-yl]benzo[f]quinoline (PubChem CID 140796953) has the molecular formula C34H29BN4O2 and a molecular weight of 536.44 g/mol. Its IUPAC name is 5-[6-pyridin-3-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-4-yl]benzo[f]quinoline.
| Compound Name | 5-[6-pyridin-3-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-4-yl]benzo[f]quinoline |
|---|---|
| PubChem CID | 140796953 |
| Molecular Formula | C34H29BN4O2 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 5-[6-pyridin-3-yl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidin-4-yl]benzo[f]quinoline |
| SMILES | CC1(C)OB(c2ccc(-c3nc(-c4cccnc4)cc(-c4cc5ccccc5c5cccnc45)n3)cc2)OC1(C)C |
| InChI | InChI=1S/C34H29BN4O2/c1-33(2)34(3,4)41-35(40-33)25-15-13-22(14-16-25)32-38-29(24-10-7-17-36-21-24)20-30(39-32)28-19-23-9-5-6-11-26(23)27-12-8-18-37-31(27)28/h5-21H,1-4H3 |
| InChIKey | DXBWIWJPHZGJDD-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|