C21H42ClN7O3 — CID 140797382
(2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[2-[2-(2-chlorocyclohexyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol (PubChem CID 140797382) has the molecular formula C21H42ClN7O3 and a molecular weight of 476.07 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[2-[2-(2-chlorocyclohexyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[2-[2-(2-chlorocyclohexyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 140797382 |
| Molecular Formula | C21H42ClN7O3 |
| Molecular Weight | 476.07 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-amino-1,2,3,4,5,6,7,8-octahydropurin-9-yl)-5-[[2-[2-(2-chlorocyclohexyl)ethylamino]ethyl-methylamino]methyl]oxolane-3,4-diol |
| SMILES | CN(CCNCCC1CCCCC1Cl)C[C@H]1O[C@@H](N2CNC3C(N)NCNC32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H42ClN7O3/c1-28(9-8-24-7-6-13-4-2-3-5-14(13)22)10-15-17(30)18(31)21(32-15)29-12-27-16-19(23)25-11-26-20(16)29/h13-21,24-27,30-31H,2-12,23H2,1H3/t13?,14?,15-,16?,17-,18-,19?,20?,21-/m1/s1 |
| InChIKey | HYDDKOGXAKGMIH-PCOXMQEASA-N |
| XLogP | -1.87 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.07 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|