C29H34F3N4O3P — CID 140797884
[4-[3-[carbamimidoyl(methyl)amino]propanoylamino]butyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate (PubChem CID 140797884) has the molecular formula C29H34F3N4O3P and a molecular weight of 574.58 g/mol. Its IUPAC name is [4-[3-[carbamimidoyl(methyl)amino]propanoylamino]butyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[3-[carbamimidoyl(methyl)amino]propanoylamino]butyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140797884 |
| Molecular Formula | C29H34F3N4O3P |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | [4-[3-[carbamimidoyl(methyl)amino]propanoylamino]butyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)N(C)CCC(=O)NCCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34F3N4O3P/c1-36(28(33)34)21-19-26(37)35-20-11-12-22-40(23-13-5-2-6-14-23,24-15-7-3-8-16-24,25-17-9-4-10-18-25)39-27(38)29(30,31)32/h2-10,13-18H,11-12,19-22H2,1H3,(H3,33,34)(H,35,37) |
| InChIKey | JITBKIGFOKULJT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|