C21H23N7O2 — CID 140797929
(9Z)-17-methyl-4,5,13,16,17,20,26-heptazatetracyclo[20.3.1.12,5.015,19]heptacosa-1(26),2(27),3,9,15,18,22,24-octaene-14,21-dione (PubChem CID 140797929) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is (9Z)-17-methyl-4,5,13,16,17,20,26-heptazatetracyclo[20.3.1.12,5.015,19]heptacosa-1(26),2(27),3,9,15,18,22,24-octaene-14,21-dione.
| Compound Name | (9Z)-17-methyl-4,5,13,16,17,20,26-heptazatetracyclo[20.3.1.12,5.015,19]heptacosa-1(26),2(27),3,9,15,18,22,24-octaene-14,21-dione |
|---|---|
| PubChem CID | 140797929 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (9Z)-17-methyl-4,5,13,16,17,20,26-heptazatetracyclo[20.3.1.12,5.015,19]heptacosa-1(26),2(27),3,9,15,18,22,24-octaene-14,21-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCC/C=C\CCCn1cc(cn1)-c1cccc(n1)C(=O)N2 |
| InChI | InChI=1S/C21H23N7O2/c1-27-14-18-19(26-27)21(30)22-10-5-3-2-4-6-11-28-13-15(12-23-28)16-8-7-9-17(24-16)20(29)25-18/h2-3,7-9,12-14H,4-6,10-11H2,1H3,(H,22,30)(H,25,29)/b3-2- |
| InChIKey | STMIMTIORZTGHK-IHWYPQMZSA-N |
| XLogP | 2.40 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|