About 2-propylsulfinyl-7,9-dihydropurin-8-one
2-propylsulfinyl-7,9-dihydropurin-8-one (PubChem CID 140797963) has the molecular formula C8H10N4O2S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-propylsulfinyl-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 2-propylsulfinyl-7,9-dihydropurin-8-one |
| PubChem CID | 140797963 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-propylsulfinyl-7,9-dihydropurin-8-one |
| SMILES | CCCS(=O)c1ncc2[nH]c(=O)[nH]c2n1 |
| InChI | InChI=1S/C8H10N4O2S/c1-2-3-15(14)8-9-4-5-6(12-8)11-7(13)10-5/h4H,2-3H2,1H3,(H2,9,10,11,12,13) |
| InChIKey | IPBZWWNWSUAQKN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propylsulfinyl-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfinyl-7,9-dihydropurin-8-one?
The IUPAC name of 2-propylsulfinyl-7,9-dihydropurin-8-one (CID 140797963) is 2-propylsulfinyl-7,9-dihydropurin-8-one.
What is the SMILES notation for 2-propylsulfinyl-7,9-dihydropurin-8-one?
The canonical SMILES for 2-propylsulfinyl-7,9-dihydropurin-8-one is CCCS(=O)c1ncc2[nH]c(=O)[nH]c2n1.
What is the InChIKey of 2-propylsulfinyl-7,9-dihydropurin-8-one?
The InChIKey is IPBZWWNWSUAQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2S/c1-2-3-15(14)8-9-4-5-6(12-8)11-7(13)10-5/h4H,2-3H2,1H3,(H2,9,10,11,12,13).
What are the key properties of 2-propylsulfinyl-7,9-dihydropurin-8-one?
2-propylsulfinyl-7,9-dihydropurin-8-one has a molecular weight of 226.26 g/mol, XLogP of 0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfinyl-7,9-dihydropurin-8-one is sourced from PubChem (CID 140797963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).